C24H17BrClN3O8 — CID 126403223
methyl 5-[[(4Z)-4-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126403223) has the molecular formula C24H17BrClN3O8 and a molecular weight of 590.77 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126403223 |
| Molecular Formula | C24H17BrClN3O8 |
| Molecular Weight | 590.77 g/mol |
| Exact Mass | 588.99 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(Br)c(OCc4ccc(Cl)cc4)c([N+](=O)[O-])c3)C2=O)o1 |
| InChI | InChI=1S/C24H17BrClN3O8/c1-35-23(31)20-7-6-16(37-20)11-28-22(30)18(27-24(28)32)9-14-8-17(25)21(19(10-14)29(33)34)36-12-13-2-4-15(26)5-3-13/h2-10H,11-12H2,1H3,(H,27,32)/b18-9- |
| InChIKey | FTUPIRUMKRKOOR-NVMNQCDNSA-N |
| XLogP | 5.06 |
| TPSA | 141.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.77 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|