C22H21N3O10 — CID 124549792
methyl 5-[[(4Z)-4-[[3-nitro-4-(2-oxo-2-propan-2-yloxyethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 124549792) has the molecular formula C22H21N3O10 and a molecular weight of 487.42 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[3-nitro-4-(2-oxo-2-propan-2-yloxyethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[3-nitro-4-(2-oxo-2-propan-2-yloxyethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 124549792 |
| Molecular Formula | C22H21N3O10 |
| Molecular Weight | 487.42 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[3-nitro-4-(2-oxo-2-propan-2-yloxyethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3ccc(OCC(=O)OC(C)C)c([N+](=O)[O-])c3)C2=O)o1 |
| InChI | InChI=1S/C22H21N3O10/c1-12(2)34-19(26)11-33-17-6-4-13(9-16(17)25(30)31)8-15-20(27)24(22(29)23-15)10-14-5-7-18(35-14)21(28)32-3/h4-9,12H,10-11H2,1-3H3,(H,23,29)/b15-8- |
| InChIKey | NKTPFLYBHWUPNT-NVNXTCNLSA-N |
| XLogP | 2.40 |
| TPSA | 167.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|