C25H18BrClN2O8 — CID 126405298
4-[[2-bromo-4-chloro-6-[(Z)-[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126405298) has the molecular formula C25H18BrClN2O8 and a molecular weight of 589.78 g/mol. Its IUPAC name is 4-[[2-bromo-4-chloro-6-[(Z)-[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-bromo-4-chloro-6-[(Z)-[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126405298 |
| Molecular Formula | C25H18BrClN2O8 |
| Molecular Weight | 589.78 g/mol |
| Exact Mass | 587.99 |
| IUPAC Name | 4-[[2-bromo-4-chloro-6-[(Z)-[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(Cl)cc(Br)c3OCc3ccc(C(=O)O)cc3)C2=O)o1 |
| InChI | InChI=1S/C25H18BrClN2O8/c1-35-24(33)20-7-6-17(37-20)11-29-22(30)19(28-25(29)34)9-15-8-16(27)10-18(26)21(15)36-12-13-2-4-14(5-3-13)23(31)32/h2-10H,11-12H2,1H3,(H,28,34)(H,31,32)/b19-9- |
| InChIKey | QPFXLOISVWIHOF-OCKHKDLRSA-N |
| XLogP | 4.85 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.78 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|