C27H22Cl2FN3O5 — CID 126221963
2-[(4E)-4-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 126221963) has the molecular formula C27H22Cl2FN3O5 and a molecular weight of 558.39 g/mol. Its IUPAC name is 2-[(4E)-4-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126221963 |
| Molecular Formula | C27H22Cl2FN3O5 |
| Molecular Weight | 558.39 g/mol |
| Exact Mass | 557.09 |
| IUPAC Name | 2-[(4E)-4-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3F)C2=O)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H22Cl2FN3O5/c1-2-37-24-12-16(7-10-23(24)38-15-17-8-9-18(28)13-19(17)29)11-22-26(35)33(27(36)32-22)14-25(34)31-21-6-4-3-5-20(21)30/h3-13H,2,14-15H2,1H3,(H,31,34)(H,32,36)/b22-11+ |
| InChIKey | AQWNPQHJWJTJCI-SSDVNMTOSA-N |
| XLogP | 5.64 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.39 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|