C28H22ClFN4O3 — CID 126223715
2-[(4E)-4-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 126223715) has the molecular formula C28H22ClFN4O3 and a molecular weight of 516.96 g/mol. Its IUPAC name is 2-[(4E)-4-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126223715 |
| Molecular Formula | C28H22ClFN4O3 |
| Molecular Weight | 516.96 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 2-[(4E)-4-[[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | Cc1c(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3F)C2=O)c2ccccc2n1Cc1ccccc1Cl |
| InChI | InChI=1S/C28H22ClFN4O3/c1-17-20(19-9-3-7-13-25(19)33(17)15-18-8-2-4-10-21(18)29)14-24-27(36)34(28(37)32-24)16-26(35)31-23-12-6-5-11-22(23)30/h2-14H,15-16H2,1H3,(H,31,35)(H,32,37)/b24-14+ |
| InChIKey | PQWHGICEGVIOTH-ZVHZXABRSA-N |
| XLogP | 5.32 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.96 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_F(8)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|