C30H25N3O2S — CID 126145275
2-[[3-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]methyl]benzonitrile (PubChem CID 126145275) has the molecular formula C30H25N3O2S and a molecular weight of 491.62 g/mol. Its IUPAC name is 2-[[3-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[3-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126145275 |
| Molecular Formula | C30H25N3O2S |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 2-[[3-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]methyl]benzonitrile |
| SMILES | Cc1c(/C=C2/SC(=O)N(CCCc3ccccc3)C2=O)c2ccccc2n1Cc1ccccc1C#N |
| InChI | InChI=1S/C30H25N3O2S/c1-21-26(18-28-29(34)32(30(35)36-28)17-9-12-22-10-3-2-4-11-22)25-15-7-8-16-27(25)33(21)20-24-14-6-5-13-23(24)19-31/h2-8,10-11,13-16,18H,9,12,17,20H2,1H3/b28-18+ |
| InChIKey | KTSAFWRPUDOUND-MTDXEUNCSA-N |
| XLogP | 6.54 |
| TPSA | 66.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|