C24H22Cl2N2O3S — CID 126249004
(5E)-5-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126249004) has the molecular formula C24H22Cl2N2O3S and a molecular weight of 489.42 g/mol. Its IUPAC name is (5E)-5-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126249004 |
| Molecular Formula | C24H22Cl2N2O3S |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | (5E)-5-[[1-[(2,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione |
| SMILES | COCCCN1C(=O)S/C(=C/c2c(C)n(Cc3ccc(Cl)cc3Cl)c3ccccc23)C1=O |
| InChI | InChI=1S/C24H22Cl2N2O3S/c1-15-19(13-22-23(29)27(24(30)32-22)10-5-11-31-2)18-6-3-4-7-21(18)28(15)14-16-8-9-17(25)12-20(16)26/h3-4,6-9,12-13H,5,10-11,14H2,1-2H3/b22-13+ |
| InChIKey | PEZUUDDFYRZXIM-LPYMAVHISA-N |
| XLogP | 6.38 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|