C32H30N4O2S2 — CID 126340207
N-[(5Z)-5-[[1-[(2-cyanophenyl)methyl]-2-methylindol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]adamantane-1-carboxamide (PubChem CID 126340207) has the molecular formula C32H30N4O2S2 and a molecular weight of 566.75 g/mol. Its IUPAC name is N-[(5Z)-5-[[1-[(2-cyanophenyl)methyl]-2-methylindol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]adamantane-1-carboxamide.
| Compound Name | N-[(5Z)-5-[[1-[(2-cyanophenyl)methyl]-2-methylindol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 126340207 |
| Molecular Formula | C32H30N4O2S2 |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | N-[(5Z)-5-[[1-[(2-cyanophenyl)methyl]-2-methylindol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]adamantane-1-carboxamide |
| SMILES | Cc1c(/C=C2\SC(=S)N(NC(=O)C34CC5CC(CC(C5)C3)C4)C2=O)c2ccccc2n1Cc1ccccc1C#N |
| InChI | InChI=1S/C32H30N4O2S2/c1-19-26(25-8-4-5-9-27(25)35(19)18-24-7-3-2-6-23(24)17-33)13-28-29(37)36(31(39)40-28)34-30(38)32-14-20-10-21(15-32)12-22(11-20)16-32/h2-9,13,20-22H,10-12,14-16,18H2,1H3,(H,34,38)/b28-13- |
| InChIKey | SWZQLHYYLZQTLX-QDTIIGTASA-N |
| XLogP | 6.32 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|