C21H21BrN2O2S2 — CID 124555593
N-[(5E)-5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]adamantane-1-carboxamide (PubChem CID 124555593) has the molecular formula C21H21BrN2O2S2 and a molecular weight of 477.45 g/mol. Its IUPAC name is N-[(5E)-5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]adamantane-1-carboxamide.
| Compound Name | N-[(5E)-5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 124555593 |
| Molecular Formula | C21H21BrN2O2S2 |
| Molecular Weight | 477.45 g/mol |
| Exact Mass | 476.02 |
| IUPAC Name | N-[(5E)-5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]adamantane-1-carboxamide |
| SMILES | O=C1/C(=C\c2cccc(Br)c2)SC(=S)N1NC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H21BrN2O2S2/c22-16-3-1-2-12(7-16)8-17-18(25)24(20(27)28-17)23-19(26)21-9-13-4-14(10-21)6-15(5-13)11-21/h1-3,7-8,13-15H,4-6,9-11H2,(H,23,26)/b17-8+ |
| InChIKey | RRBPNNWFRVVXPU-CAOOACKPSA-N |
| XLogP | 4.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|