C28H24F3N3O5S2 — CID 126145547
N-[(5E)-5-[[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]adamantane-1-carboxamide (PubChem CID 126145547) has the molecular formula C28H24F3N3O5S2 and a molecular weight of 603.64 g/mol. Its IUPAC name is N-[(5E)-5-[[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]adamantane-1-carboxamide.
| Compound Name | N-[(5E)-5-[[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 126145547 |
| Molecular Formula | C28H24F3N3O5S2 |
| Molecular Weight | 603.64 g/mol |
| Exact Mass | 603.11 |
| IUPAC Name | N-[(5E)-5-[[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]adamantane-1-carboxamide |
| SMILES | O=C1/C(=C\c2cccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c2)SC(=S)N1NC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H24F3N3O5S2/c29-28(30,31)19-4-5-22(21(11-19)34(37)38)39-20-3-1-2-15(9-20)10-23-24(35)33(26(40)41-23)32-25(36)27-12-16-6-17(13-27)8-18(7-16)14-27/h1-5,9-11,16-18H,6-8,12-14H2,(H,32,36)/b23-10+ |
| InChIKey | BAUHODCIHYBUBS-AUEPDCJTSA-N |
| XLogP | 6.85 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.64 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|