C23H24F2N2O4S2 — CID 126364795
N-[(5Z)-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]adamantane-1-carboxamide (PubChem CID 126364795) has the molecular formula C23H24F2N2O4S2 and a molecular weight of 494.59 g/mol. Its IUPAC name is N-[(5Z)-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]adamantane-1-carboxamide.
| Compound Name | N-[(5Z)-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 126364795 |
| Molecular Formula | C23H24F2N2O4S2 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | N-[(5Z)-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]adamantane-1-carboxamide |
| SMILES | COc1cc(/C=C2\SC(=S)N(NC(=O)C34CC5CC(CC(C5)C3)C4)C2=O)ccc1OC(F)F |
| InChI | InChI=1S/C23H24F2N2O4S2/c1-30-17-7-12(2-3-16(17)31-21(24)25)8-18-19(28)27(22(32)33-18)26-20(29)23-9-13-4-14(10-23)6-15(5-13)11-23/h2-3,7-8,13-15,21H,4-6,9-11H2,1H3,(H,26,29)/b18-8- |
| InChIKey | XXCKLRXBQMUIEU-LSCVHKIXSA-N |
| XLogP | 4.75 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|