C26H19I2N3O3S — CID 137139124
2-[[4-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]methyl]benzonitrile (PubChem CID 137139124) has the molecular formula C26H19I2N3O3S and a molecular weight of 707.33 g/mol. Its IUPAC name is 2-[[4-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 137139124 |
| Molecular Formula | C26H19I2N3O3S |
| Molecular Weight | 707.33 g/mol |
| Exact Mass | 706.92 |
| IUPAC Name | 2-[[4-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]methyl]benzonitrile |
| SMILES | CCOc1ccc(/N=C2/NC(=O)/C(=C\c3cc(I)c(OCc4ccccc4C#N)c(I)c3)S2)cc1 |
| InChI | InChI=1S/C26H19I2N3O3S/c1-2-33-20-9-7-19(8-10-20)30-26-31-25(32)23(35-26)13-16-11-21(27)24(22(28)12-16)34-15-18-6-4-3-5-17(18)14-29/h3-13H,2,15H2,1H3,(H,30,31,32)/b23-13+ |
| InChIKey | DZVLIYWXRMCQMG-YDZHTSKRSA-N |
| XLogP | 6.64 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.33 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|