C28H24Cl3N3O5S — CID 126182324
propyl 2-chloro-5-[[2-[(5Z)-5-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126182324) has the molecular formula C28H24Cl3N3O5S and a molecular weight of 620.94 g/mol. Its IUPAC name is propyl 2-chloro-5-[[2-[(5Z)-5-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | propyl 2-chloro-5-[[2-[(5Z)-5-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126182324 |
| Molecular Formula | C28H24Cl3N3O5S |
| Molecular Weight | 620.94 g/mol |
| Exact Mass | 619.05 |
| IUPAC Name | propyl 2-chloro-5-[[2-[(5Z)-5-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C\c3cc(C)n(-c4ccc(Cl)c(Cl)c4)c3C)C2=O)ccc1Cl |
| InChI | InChI=1S/C28H24Cl3N3O5S/c1-4-9-39-27(37)20-12-18(5-7-21(20)29)32-25(35)14-33-26(36)24(40-28(33)38)11-17-10-15(2)34(16(17)3)19-6-8-22(30)23(31)13-19/h5-8,10-13H,4,9,14H2,1-3H3,(H,32,35)/b24-11- |
| InChIKey | XLQVNNVEZPEBKW-MYKKPKGFSA-N |
| XLogP | 7.30 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.94 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|