C31H25ClN2O5S — CID 126098839
2-[(5E)-5-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 126098839) has the molecular formula C31H25ClN2O5S and a molecular weight of 573.07 g/mol. Its IUPAC name is 2-[(5E)-5-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126098839 |
| Molecular Formula | C31H25ClN2O5S |
| Molecular Weight | 573.07 g/mol |
| Exact Mass | 572.12 |
| IUPAC Name | 2-[(5E)-5-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CN2C(=O)S/C(=C/c3c(OCc4ccc(Cl)cc4)ccc4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C31H25ClN2O5S/c1-2-38-24-14-12-23(13-15-24)33-29(35)18-34-30(36)28(40-31(34)37)17-26-25-6-4-3-5-21(25)9-16-27(26)39-19-20-7-10-22(32)11-8-20/h3-17H,2,18-19H2,1H3,(H,33,35)/b28-17+ |
| InChIKey | YXZSQSFZINZINK-OGLMXYFKSA-N |
| XLogP | 7.15 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.07 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|