C23H23Cl2N3O4S2 — CID 126373301
1-[(5E)-5-[[4-[(2S)-butan-2-yl]oxy-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(3,4-dichlorophenyl)urea (PubChem CID 126373301) has the molecular formula C23H23Cl2N3O4S2 and a molecular weight of 540.49 g/mol. Its IUPAC name is 1-[(5E)-5-[[4-[(2S)-butan-2-yl]oxy-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[(5E)-5-[[4-[(2S)-butan-2-yl]oxy-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 126373301 |
| Molecular Formula | C23H23Cl2N3O4S2 |
| Molecular Weight | 540.49 g/mol |
| Exact Mass | 539.05 |
| IUPAC Name | 1-[(5E)-5-[[4-[(2S)-butan-2-yl]oxy-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(3,4-dichlorophenyl)urea |
| SMILES | CCOc1cc(/C=C2/SC(=S)N(NC(=O)Nc3ccc(Cl)c(Cl)c3)C2=O)ccc1O[C@@H](C)CC |
| InChI | InChI=1S/C23H23Cl2N3O4S2/c1-4-13(3)32-18-9-6-14(10-19(18)31-5-2)11-20-21(29)28(23(33)34-20)27-22(30)26-15-7-8-16(24)17(25)12-15/h6-13H,4-5H2,1-3H3,(H2,26,27,30)/b20-11+/t13-/m0/s1 |
| InChIKey | GRXQNXQBUHTXJX-HSWQHBDASA-N |
| XLogP | 6.51 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.49 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|