C29H23N3O4S3 — CID 126358685
N-(1,3-benzodioxol-5-yl)-2-[2-methyl-3-[(Z)-[3-(3-methylsulfanylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide (PubChem CID 126358685) has the molecular formula C29H23N3O4S3 and a molecular weight of 573.72 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[2-methyl-3-[(Z)-[3-(3-methylsulfanylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[2-methyl-3-[(Z)-[3-(3-methylsulfanylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 126358685 |
| Molecular Formula | C29H23N3O4S3 |
| Molecular Weight | 573.72 g/mol |
| Exact Mass | 573.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[2-methyl-3-[(Z)-[3-(3-methylsulfanylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide |
| SMILES | CSc1cccc(N2C(=O)/C(=C/c3c(C)n(CC(=O)Nc4ccc5c(c4)OCO5)c4ccccc34)SC2=S)c1 |
| InChI | InChI=1S/C29H23N3O4S3/c1-17-22(14-26-28(34)32(29(37)39-26)19-6-5-7-20(13-19)38-2)21-8-3-4-9-23(21)31(17)15-27(33)30-18-10-11-24-25(12-18)36-16-35-24/h3-14H,15-16H2,1-2H3,(H,30,33)/b26-14- |
| InChIKey | YGDNSCQOCHQCJK-WGARJPEWSA-N |
| XLogP | 6.44 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.72 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|