C25H23N3O5S — CID 126356677
N-(1,3-benzodioxol-5-yl)-2-[3-[(Z)-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-ylidene)methyl]-2-methylindol-1-yl]acetamide (PubChem CID 126356677) has the molecular formula C25H23N3O5S and a molecular weight of 477.54 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[3-[(Z)-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-ylidene)methyl]-2-methylindol-1-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[3-[(Z)-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-ylidene)methyl]-2-methylindol-1-yl]acetamide |
|---|---|
| PubChem CID | 126356677 |
| Molecular Formula | C25H23N3O5S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[3-[(Z)-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-ylidene)methyl]-2-methylindol-1-yl]acetamide |
| SMILES | CCCN1C(=O)S/C(=C\c2c(C)n(CC(=O)Nc3ccc4c(c3)OCO4)c3ccccc23)C1=O |
| InChI | InChI=1S/C25H23N3O5S/c1-3-10-27-24(30)22(34-25(27)31)12-18-15(2)28(19-7-5-4-6-17(18)19)13-23(29)26-16-8-9-20-21(11-16)33-14-32-20/h4-9,11-12H,3,10,13-14H2,1-2H3,(H,26,29)/b22-12- |
| InChIKey | VBDRLVBZDJCXNN-UUYOSTAYSA-N |
| XLogP | 4.76 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|