C28H20ClN3O5S — CID 126347809
N-(1,3-benzodioxol-5-yl)-2-[3-[(E)-[3-(3-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]acetamide (PubChem CID 126347809) has the molecular formula C28H20ClN3O5S and a molecular weight of 546.00 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[3-[(E)-[3-(3-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[3-[(E)-[3-(3-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]acetamide |
|---|---|
| PubChem CID | 126347809 |
| Molecular Formula | C28H20ClN3O5S |
| Molecular Weight | 546.00 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[3-[(E)-[3-(3-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]acetamide |
| SMILES | Cc1c(/C=C2/SC(=O)N(c3cccc(Cl)c3)C2=O)c2ccccc2n1CC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H20ClN3O5S/c1-16-21(13-25-27(34)32(28(35)38-25)19-6-4-5-17(29)11-19)20-7-2-3-8-22(20)31(16)14-26(33)30-18-9-10-23-24(12-18)37-15-36-23/h2-13H,14-15H2,1H3,(H,30,33)/b25-13+ |
| InChIKey | FUVIFWJKHOHXDO-DHRITJCHSA-N |
| XLogP | 6.21 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.00 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|