C22H18N4O4S2 — CID 126351476
N-(1,3-benzodioxol-5-yl)-2-[2-methyl-3-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]indol-1-yl]acetamide (PubChem CID 126351476) has the molecular formula C22H18N4O4S2 and a molecular weight of 466.54 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[2-methyl-3-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]indol-1-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[2-methyl-3-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 126351476 |
| Molecular Formula | C22H18N4O4S2 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[2-methyl-3-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]indol-1-yl]acetamide |
| SMILES | Cc1c(/C=N\N2C(=O)CSC2=S)c2ccccc2n1CC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H18N4O4S2/c1-13-16(9-23-26-21(28)11-32-22(26)31)15-4-2-3-5-17(15)25(13)10-20(27)24-14-6-7-18-19(8-14)30-12-29-18/h2-9H,10-12H2,1H3,(H,24,27)/b23-9- |
| InChIKey | JKWDHUKPLBBCQU-AQHIEDMUSA-N |
| XLogP | 3.51 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|