C24H18ClNO5S2 — CID 78153652
3-hydroxypropyl 3-[5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate (PubChem CID 78153652) has the molecular formula C24H18ClNO5S2 and a molecular weight of 500.00 g/mol. Its IUPAC name is 3-hydroxypropyl 3-[5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate.
| Compound Name | 3-hydroxypropyl 3-[5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate |
|---|---|
| PubChem CID | 78153652 |
| Molecular Formula | C24H18ClNO5S2 |
| Molecular Weight | 500.00 g/mol |
| Exact Mass | 499.03 |
| IUPAC Name | 3-hydroxypropyl 3-[5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate |
| SMILES | O=C(OCCCO)c1cccc(N2C(=O)C(=Cc3ccc(-c4ccccc4Cl)o3)SC2=S)c1 |
| InChI | InChI=1S/C24H18ClNO5S2/c25-19-8-2-1-7-18(19)20-10-9-17(31-20)14-21-22(28)26(24(32)33-21)16-6-3-5-15(13-16)23(29)30-12-4-11-27/h1-3,5-10,13-14,27H,4,11-12H2 |
| InChIKey | JGOIDAUVPJSXAE-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.00 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|