C27H25NO5S — CID 124665418
butyl 4-[5-[(E)-[3-[(3-methylphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 124665418) has the molecular formula C27H25NO5S and a molecular weight of 475.57 g/mol. Its IUPAC name is butyl 4-[5-[(E)-[3-[(3-methylphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | butyl 4-[5-[(E)-[3-[(3-methylphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 124665418 |
| Molecular Formula | C27H25NO5S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | butyl 4-[5-[(E)-[3-[(3-methylphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(-c2ccc(/C=C3/SC(=O)N(Cc4cccc(C)c4)C3=O)o2)cc1 |
| InChI | InChI=1S/C27H25NO5S/c1-3-4-14-32-26(30)21-10-8-20(9-11-21)23-13-12-22(33-23)16-24-25(29)28(27(31)34-24)17-19-7-5-6-18(2)15-19/h5-13,15-16H,3-4,14,17H2,1-2H3/b24-16+ |
| InChIKey | OUPJLSXWDRYJGB-LFVJCYFKSA-N |
| XLogP | 6.45 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|