C25H30N2O6 — CID 27209481
(5E)-1-[(1R)-1-(1-adamantyl)ethyl]-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 27209481) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is (5E)-1-[(1R)-1-(1-adamantyl)ethyl]-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-[(1R)-1-(1-adamantyl)ethyl]-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 27209481 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | (5E)-1-[(1R)-1-(1-adamantyl)ethyl]-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cc(/C=C2\C(=O)NC(=O)N([C@H](C)C34CC5CC(CC(C5)C3)C4)C2=O)cc(OC)c1O |
| InChI | InChI=1S/C25H30N2O6/c1-13(25-10-15-4-16(11-25)6-17(5-15)12-25)27-23(30)18(22(29)26-24(27)31)7-14-8-19(32-2)21(28)20(9-14)33-3/h7-9,13,15-17,28H,4-6,10-12H2,1-3H3,(H,26,29,31)/b18-7+/t13-,15?,16?,17?,25?/m1/s1 |
| InChIKey | OUQWOMZFCLJOGG-TZCPFCGOSA-N |
| XLogP | 3.48 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|