C28H36N2O5 — CID 4230583
1-[1-(1-adamantyl)ethyl]-5-[[3-methoxy-4-(2-methylpropoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 4230583) has the molecular formula C28H36N2O5 and a molecular weight of 480.61 g/mol. Its IUPAC name is 1-[1-(1-adamantyl)ethyl]-5-[[3-methoxy-4-(2-methylpropoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[1-(1-adamantyl)ethyl]-5-[[3-methoxy-4-(2-methylpropoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 4230583 |
| Molecular Formula | C28H36N2O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 1-[1-(1-adamantyl)ethyl]-5-[[3-methoxy-4-(2-methylpropoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cc(C=C2C(=O)NC(=O)N(C(C)C34CC5CC(CC(C5)C3)C4)C2=O)ccc1OCC(C)C |
| InChI | InChI=1S/C28H36N2O5/c1-16(2)15-35-23-6-5-18(11-24(23)34-4)10-22-25(31)29-27(33)30(26(22)32)17(3)28-12-19-7-20(13-28)9-21(8-19)14-28/h5-6,10-11,16-17,19-21H,7-9,12-15H2,1-4H3,(H,29,31,33) |
| InChIKey | JGFSNKYPPIWDTD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|