C18H14Cl2N2O4S — CID 44513460
2-[(4Z)-4-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-5-oxo-2-sulfanylideneimidazolidin-1-yl]butanoic acid (PubChem CID 44513460) has the molecular formula C18H14Cl2N2O4S and a molecular weight of 425.29 g/mol. Its IUPAC name is 2-[(4Z)-4-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-5-oxo-2-sulfanylideneimidazolidin-1-yl]butanoic acid.
| Compound Name | 2-[(4Z)-4-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-5-oxo-2-sulfanylideneimidazolidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 44513460 |
| Molecular Formula | C18H14Cl2N2O4S |
| Molecular Weight | 425.29 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | 2-[(4Z)-4-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-5-oxo-2-sulfanylideneimidazolidin-1-yl]butanoic acid |
| SMILES | CCC(C(=O)O)N1C(=O)/C(=C/c2ccc(-c3ccc(Cl)c(Cl)c3)o2)NC1=S |
| InChI | InChI=1S/C18H14Cl2N2O4S/c1-2-14(17(24)25)22-16(23)13(21-18(22)27)8-10-4-6-15(26-10)9-3-5-11(19)12(20)7-9/h3-8,14H,2H2,1H3,(H,21,27)(H,24,25)/b13-8- |
| InChIKey | XZAWBGZXRVLBTD-JYRVWZFOSA-N |
| XLogP | 4.17 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|