C26H24N2O4 — CID 50886527
2-methylpropyl 3-[5-[(Z)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 50886527) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-methylpropyl 3-[5-[(Z)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | 2-methylpropyl 3-[5-[(Z)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 50886527 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2-methylpropyl 3-[5-[(Z)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | CC1=NN(c2ccccc2)C(=O)/C1=C\c1ccc(-c2cccc(C(=O)OCC(C)C)c2)o1 |
| InChI | InChI=1S/C26H24N2O4/c1-17(2)16-31-26(30)20-9-7-8-19(14-20)24-13-12-22(32-24)15-23-18(3)27-28(25(23)29)21-10-5-4-6-11-21/h4-15,17H,16H2,1-3H3/b23-15- |
| InChIKey | QGUSCJUTWGZEOD-HAHDFKILSA-N |
| XLogP | 5.57 |
| TPSA | 72.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|