C33H28FN3O3 — CID 142548378
N-[(4-fluorophenyl)methyl]-2-methyl-5-[5-[(Z)-[3-methyl-5-oxo-1-(3-prop-1-en-2-ylphenyl)pyrazol-4-ylidene]methyl]furan-2-yl]benzamide (PubChem CID 142548378) has the molecular formula C33H28FN3O3 and a molecular weight of 533.60 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-methyl-5-[5-[(Z)-[3-methyl-5-oxo-1-(3-prop-1-en-2-ylphenyl)pyrazol-4-ylidene]methyl]furan-2-yl]benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-methyl-5-[5-[(Z)-[3-methyl-5-oxo-1-(3-prop-1-en-2-ylphenyl)pyrazol-4-ylidene]methyl]furan-2-yl]benzamide |
|---|---|
| PubChem CID | 142548378 |
| Molecular Formula | C33H28FN3O3 |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-methyl-5-[5-[(Z)-[3-methyl-5-oxo-1-(3-prop-1-en-2-ylphenyl)pyrazol-4-ylidene]methyl]furan-2-yl]benzamide |
| SMILES | C=C(C)c1cccc(N2N=C(C)/C(=C/c3ccc(-c4ccc(C)c(C(=O)NCc5ccc(F)cc5)c4)o3)C2=O)c1 |
| InChI | InChI=1S/C33H28FN3O3/c1-20(2)24-6-5-7-27(16-24)37-33(39)30(22(4)36-37)18-28-14-15-31(40-28)25-11-8-21(3)29(17-25)32(38)35-19-23-9-12-26(34)13-10-23/h5-18H,1,19H2,2-4H3,(H,35,38)/b30-18- |
| InChIKey | RHVKOAQOLMXKSW-YKQZZPSBSA-N |
| XLogP | 7.16 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|