C26H23N3O5 — CID 142548379
N-(cyclopropylmethyl)-2-hydroxy-5-[5-[(Z)-[1-(3-hydroxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]benzamide (PubChem CID 142548379) has the molecular formula C26H23N3O5 and a molecular weight of 457.49 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-hydroxy-5-[5-[(Z)-[1-(3-hydroxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]benzamide.
| Compound Name | N-(cyclopropylmethyl)-2-hydroxy-5-[5-[(Z)-[1-(3-hydroxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]benzamide |
|---|---|
| PubChem CID | 142548379 |
| Molecular Formula | C26H23N3O5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | N-(cyclopropylmethyl)-2-hydroxy-5-[5-[(Z)-[1-(3-hydroxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]benzamide |
| SMILES | CC1=NN(c2cccc(O)c2)C(=O)/C1=C\c1ccc(-c2ccc(O)c(C(=O)NCC3CC3)c2)o1 |
| InChI | InChI=1S/C26H23N3O5/c1-15-21(26(33)29(28-15)18-3-2-4-19(30)12-18)13-20-8-10-24(34-20)17-7-9-23(31)22(11-17)25(32)27-14-16-5-6-16/h2-4,7-13,16,30-31H,5-6,14H2,1H3,(H,27,32)/b21-13- |
| InChIKey | SGXYDHRYZMYTGD-BKUYFWCQSA-N |
| XLogP | 4.30 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|