C32H30ClN3O4 — CID 158322364
2-chloro-N-(cyclopropylmethyl)-5-[5-[(Z)-[1-[3-(3-cyclopropylpropanoyl)phenyl]-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]benzamide (PubChem CID 158322364) has the molecular formula C32H30ClN3O4 and a molecular weight of 556.06 g/mol. Its IUPAC name is 2-chloro-N-(cyclopropylmethyl)-5-[5-[(Z)-[1-[3-(3-cyclopropylpropanoyl)phenyl]-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]benzamide.
| Compound Name | 2-chloro-N-(cyclopropylmethyl)-5-[5-[(Z)-[1-[3-(3-cyclopropylpropanoyl)phenyl]-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]benzamide |
|---|---|
| PubChem CID | 158322364 |
| Molecular Formula | C32H30ClN3O4 |
| Molecular Weight | 556.06 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | 2-chloro-N-(cyclopropylmethyl)-5-[5-[(Z)-[1-[3-(3-cyclopropylpropanoyl)phenyl]-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]benzamide |
| SMILES | CC1=NN(c2cccc(C(=O)CCC3CC3)c2)C(=O)/C1=C\c1ccc(-c2ccc(Cl)c(C(=O)NCC3CC3)c2)o1 |
| InChI | InChI=1S/C32H30ClN3O4/c1-19-26(32(39)36(35-19)24-4-2-3-22(15-24)29(37)13-9-20-5-6-20)17-25-11-14-30(40-25)23-10-12-28(33)27(16-23)31(38)34-18-21-7-8-21/h2-4,10-12,14-17,20-21H,5-9,13,18H2,1H3,(H,34,38)/b26-17- |
| InChIKey | GOZTYNHYUVZPQZ-ONUIUJJFSA-N |
| XLogP | 6.92 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.06 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|