C31H21F3N4O3 — CID 21211165
N-[(Z)-[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-3-(trifluoromethyl)benzamide (PubChem CID 21211165) has the molecular formula C31H21F3N4O3 and a molecular weight of 554.53 g/mol. Its IUPAC name is N-[(Z)-[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(Z)-[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 21211165 |
| Molecular Formula | C31H21F3N4O3 |
| Molecular Weight | 554.53 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | N-[(Z)-[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(N/N=C\c1cc(-c2ccccc2)n(-c2ccc([N+](=O)[O-])cc2)c1-c1ccccc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H21F3N4O3/c32-31(33,34)25-13-7-12-23(18-25)30(39)36-35-20-24-19-28(21-8-3-1-4-9-21)37(29(24)22-10-5-2-6-11-22)26-14-16-27(17-15-26)38(40)41/h1-20H,(H,36,39)/b35-20- |
| InChIKey | KHKBTYXQYBTWQP-OJYCWLPVSA-N |
| XLogP | 7.50 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.53 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|