C25H19ClIN3O2 — CID 137173786
N-[(E)-(5-chloro-2-hydroxy-3-iodophenyl)methylideneamino]-4-(2-methyl-5-phenylpyrrol-1-yl)benzamide (PubChem CID 137173786) has the molecular formula C25H19ClIN3O2 and a molecular weight of 555.80 g/mol. Its IUPAC name is N-[(E)-(5-chloro-2-hydroxy-3-iodophenyl)methylideneamino]-4-(2-methyl-5-phenylpyrrol-1-yl)benzamide.
| Compound Name | N-[(E)-(5-chloro-2-hydroxy-3-iodophenyl)methylideneamino]-4-(2-methyl-5-phenylpyrrol-1-yl)benzamide |
|---|---|
| PubChem CID | 137173786 |
| Molecular Formula | C25H19ClIN3O2 |
| Molecular Weight | 555.80 g/mol |
| Exact Mass | 555.02 |
| IUPAC Name | N-[(E)-(5-chloro-2-hydroxy-3-iodophenyl)methylideneamino]-4-(2-methyl-5-phenylpyrrol-1-yl)benzamide |
| SMILES | Cc1ccc(-c2ccccc2)n1-c1ccc(C(=O)N/N=C/c2cc(Cl)cc(I)c2O)cc1 |
| InChI | InChI=1S/C25H19ClIN3O2/c1-16-7-12-23(17-5-3-2-4-6-17)30(16)21-10-8-18(9-11-21)25(32)29-28-15-19-13-20(26)14-22(27)24(19)31/h2-15,31H,1H3,(H,29,32)/b28-15+ |
| InChIKey | ZENNSBKACUVYNZ-RWPZCVJISA-N |
| XLogP | 6.18 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.80 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|