C28H22Br2N2O3 — CID 126191522
N-[(Z)-[4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide (PubChem CID 126191522) has the molecular formula C28H22Br2N2O3 and a molecular weight of 594.30 g/mol. Its IUPAC name is N-[(Z)-[4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide.
| Compound Name | N-[(Z)-[4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 126191522 |
| Molecular Formula | C28H22Br2N2O3 |
| Molecular Weight | 594.30 g/mol |
| Exact Mass | 592.00 |
| IUPAC Name | N-[(Z)-[4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
| SMILES | O=C(N/N=C\c1ccc(OCc2ccc(Br)cc2Br)cc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H22Br2N2O3/c29-24-14-13-21(26(30)17-24)19-35-25-15-11-20(12-16-25)18-31-32-27(33)28(34,22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-18,34H,19H2,(H,32,33)/b31-18- |
| InChIKey | VGQYMADZOLJTSN-MNBJERMJSA-N |
| XLogP | 6.18 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.30 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|