C23H21Br2N3O2 — CID 126194341
1-[(E)-[4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-3-(2,3-dimethylphenyl)urea (PubChem CID 126194341) has the molecular formula C23H21Br2N3O2 and a molecular weight of 531.25 g/mol. Its IUPAC name is 1-[(E)-[4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-3-(2,3-dimethylphenyl)urea.
| Compound Name | 1-[(E)-[4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-3-(2,3-dimethylphenyl)urea |
|---|---|
| PubChem CID | 126194341 |
| Molecular Formula | C23H21Br2N3O2 |
| Molecular Weight | 531.25 g/mol |
| Exact Mass | 529.00 |
| IUPAC Name | 1-[(E)-[4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-3-(2,3-dimethylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)N/N=C/c2ccc(OCc3ccc(Br)cc3Br)cc2)c1C |
| InChI | InChI=1S/C23H21Br2N3O2/c1-15-4-3-5-22(16(15)2)27-23(29)28-26-13-17-6-10-20(11-7-17)30-14-18-8-9-19(24)12-21(18)25/h3-13H,14H2,1-2H3,(H2,27,28,29)/b26-13+ |
| InChIKey | AEWFXJAKDPPRMY-LGJNPRDNSA-N |
| XLogP | 6.56 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.25 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|