C21H16Br2ClN3O2 — CID 126192638
1-(4-chlorophenyl)-3-[(E)-[4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]urea (PubChem CID 126192638) has the molecular formula C21H16Br2ClN3O2 and a molecular weight of 537.64 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(E)-[4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(E)-[4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 126192638 |
| Molecular Formula | C21H16Br2ClN3O2 |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 534.93 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(E)-[4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]urea |
| SMILES | O=C(N/N=C/c1ccc(OCc2ccc(Br)cc2Br)cc1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H16Br2ClN3O2/c22-16-4-3-15(20(23)11-16)13-29-19-9-1-14(2-10-19)12-25-27-21(28)26-18-7-5-17(24)6-8-18/h1-12H,13H2,(H2,26,27,28)/b25-12+ |
| InChIKey | BGQVJWVQJZJCKC-BRJLIKDPSA-N |
| XLogP | 6.60 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|