C28H23FN2O3 — CID 96890733
N-[(E)-[4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide (PubChem CID 96890733) has the molecular formula C28H23FN2O3 and a molecular weight of 454.50 g/mol. Its IUPAC name is N-[(E)-[4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide.
| Compound Name | N-[(E)-[4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 96890733 |
| Molecular Formula | C28H23FN2O3 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | N-[(E)-[4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
| SMILES | O=C(N/N=C/c1ccc(OCc2cccc(F)c2)cc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H23FN2O3/c29-25-13-7-8-22(18-25)20-34-26-16-14-21(15-17-26)19-30-31-27(32)28(33,23-9-3-1-4-10-23)24-11-5-2-6-12-24/h1-19,33H,20H2,(H,31,32)/b30-19+ |
| InChIKey | QFQIUBJBXHBLDM-NDZAJKAJSA-N |
| XLogP | 4.79 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|