C25H20FN3O2 — CID 5081535
N-[[4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-4-pyrrol-1-ylbenzamide (PubChem CID 5081535) has the molecular formula C25H20FN3O2 and a molecular weight of 413.45 g/mol. Its IUPAC name is N-[[4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-4-pyrrol-1-ylbenzamide.
| Compound Name | N-[[4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-4-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 5081535 |
| Molecular Formula | C25H20FN3O2 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-[[4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-4-pyrrol-1-ylbenzamide |
| SMILES | O=C(NN=Cc1ccc(OCc2cccc(F)c2)cc1)c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C25H20FN3O2/c26-22-5-3-4-20(16-22)18-31-24-12-6-19(7-13-24)17-27-28-25(30)21-8-10-23(11-9-21)29-14-1-2-15-29/h1-17H,18H2,(H,28,30) |
| InChIKey | VCHGXJMLAVEZIO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|