C21H20BrClN4O3 — CID 6293300
N-[1-[(2Z)-2-[[3-bromo-4-(cyanomethoxy)phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3-chlorobenzamide (PubChem CID 6293300) has the molecular formula C21H20BrClN4O3 and a molecular weight of 491.77 g/mol. Its IUPAC name is N-[1-[(2Z)-2-[[3-bromo-4-(cyanomethoxy)phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3-chlorobenzamide.
| Compound Name | N-[1-[(2Z)-2-[[3-bromo-4-(cyanomethoxy)phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 6293300 |
| Molecular Formula | C21H20BrClN4O3 |
| Molecular Weight | 491.77 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | N-[1-[(2Z)-2-[[3-bromo-4-(cyanomethoxy)phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3-chlorobenzamide |
| SMILES | CC(C)C(NC(=O)c1cccc(Cl)c1)C(=O)N/N=C\c1ccc(OCC#N)c(Br)c1 |
| InChI | InChI=1S/C21H20BrClN4O3/c1-13(2)19(26-20(28)15-4-3-5-16(23)11-15)21(29)27-25-12-14-6-7-18(17(22)10-14)30-9-8-24/h3-7,10-13,19H,9H2,1-2H3,(H,26,28)(H,27,29)/b25-12- |
| InChIKey | XOSQIONVOGGJSZ-ROTLSHHCSA-N |
| XLogP | 3.91 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.77 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|