C29H29Cl2N3O6 — CID 3890041
N-[1-[2-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxyphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide (PubChem CID 3890041) has the molecular formula C29H29Cl2N3O6 and a molecular weight of 586.47 g/mol. Its IUPAC name is N-[1-[2-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxyphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide.
| Compound Name | N-[1-[2-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxyphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 3890041 |
| Molecular Formula | C29H29Cl2N3O6 |
| Molecular Weight | 586.47 g/mol |
| Exact Mass | 585.14 |
| IUPAC Name | N-[1-[2-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxyphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide |
| SMILES | CCOc1cc(C=NNC(=O)C(NC(=O)c2ccc(Cl)cc2Cl)C(C)C)ccc1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C29H29Cl2N3O6/c1-4-37-25-11-18(5-9-23(25)38-15-19-6-10-24-26(12-19)40-16-39-24)14-32-34-29(36)27(17(2)3)33-28(35)21-8-7-20(30)13-22(21)31/h5-14,17,27H,4,15-16H2,1-3H3,(H,33,35)(H,34,36) |
| InChIKey | ISSNJOFUOSZDLK-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|