C19H23N3O8S — CID 110517530
N-[(E)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]-3,4-dimethoxybenzenesulfonamide (PubChem CID 110517530) has the molecular formula C19H23N3O8S and a molecular weight of 453.47 g/mol. Its IUPAC name is N-[(E)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[(E)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 110517530 |
| Molecular Formula | C19H23N3O8S |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | N-[(E)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]-3,4-dimethoxybenzenesulfonamide |
| SMILES | CCOc1cc(OCC)c([N+](=O)[O-])cc1/C=N/NS(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H23N3O8S/c1-5-29-17-11-18(30-6-2)15(22(23)24)9-13(17)12-20-21-31(25,26)14-7-8-16(27-3)19(10-14)28-4/h7-12,21H,5-6H2,1-4H3/b20-12+ |
| InChIKey | FUBCDLXAQDJZKQ-UDWIEESQSA-N |
| XLogP | 2.72 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|