C15H15N3O7S — CID 136873444
N-[(E)-(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-4-ethoxybenzenesulfonamide (PubChem CID 136873444) has the molecular formula C15H15N3O7S and a molecular weight of 381.37 g/mol. Its IUPAC name is N-[(E)-(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-4-ethoxybenzenesulfonamide.
| Compound Name | N-[(E)-(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-4-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 136873444 |
| Molecular Formula | C15H15N3O7S |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | N-[(E)-(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-4-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N/N=C/c2cc([N+](=O)[O-])c(O)cc2O)cc1 |
| InChI | InChI=1S/C15H15N3O7S/c1-2-25-11-3-5-12(6-4-11)26(23,24)17-16-9-10-7-13(18(21)22)15(20)8-14(10)19/h3-9,17,19-20H,2H2,1H3/b16-9+ |
| InChIKey | PCVPJXGPYUPVAS-CXUHLZMHSA-N |
| XLogP | 1.72 |
| TPSA | 151.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|