C18H13N7O5 — CID 3097180
N-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-N'-pyridin-2-ylpyridine-2-carboximidamide (PubChem CID 3097180) has the molecular formula C18H13N7O5 and a molecular weight of 407.35 g/mol. Its IUPAC name is N-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-N'-pyridin-2-ylpyridine-2-carboximidamide.
| Compound Name | N-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-N'-pyridin-2-ylpyridine-2-carboximidamide |
|---|---|
| PubChem CID | 3097180 |
| Molecular Formula | C18H13N7O5 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | N-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-N'-pyridin-2-ylpyridine-2-carboximidamide |
| SMILES | O=[N+]([O-])c1cc(C=NNC(=Nc2ccccn2)c2ccccn2)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H13N7O5/c26-17-12(9-13(24(27)28)10-15(17)25(29)30)11-21-23-18(14-5-1-3-7-19-14)22-16-6-2-4-8-20-16/h1-11,26H,(H,20,22,23) |
| InChIKey | YXHFYSBSJPNOKG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 169.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|