C24H27N3O3 — CID 92850815
N-[(Z)-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(2-methoxyphenoxy)acetamide (PubChem CID 92850815) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[(Z)-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(2-methoxyphenoxy)acetamide.
| Compound Name | N-[(Z)-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 92850815 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | N-[(Z)-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(2-methoxyphenoxy)acetamide |
| SMILES | COc1ccccc1OCC(=O)N/N=C\c1cc(C)n(-c2ccc(C)c(C)c2)c1C |
| InChI | InChI=1S/C24H27N3O3/c1-16-10-11-21(12-17(16)2)27-18(3)13-20(19(27)4)14-25-26-24(28)15-30-23-9-7-6-8-22(23)29-5/h6-14H,15H2,1-5H3,(H,26,28)/b25-14- |
| InChIKey | MNRXBWZHNQKDAH-QFEZKATASA-N |
| XLogP | 4.25 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|