C29H28Cl2N4O5S — CID 98097273
2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-[(Z)-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide (PubChem CID 98097273) has the molecular formula C29H28Cl2N4O5S and a molecular weight of 615.54 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-[(Z)-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-[(Z)-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 98097273 |
| Molecular Formula | C29H28Cl2N4O5S |
| Molecular Weight | 615.54 g/mol |
| Exact Mass | 614.12 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-[(Z)-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)N/N=C\c2cc(C)n(-c3ccc(Cl)c(Cl)c3)c2C)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C29H28Cl2N4O5S/c1-19-14-21(20(2)35(19)22-10-12-25(30)26(31)15-22)17-32-33-29(36)18-34(41(37,38)24-8-6-5-7-9-24)27-16-23(39-3)11-13-28(27)40-4/h5-17H,18H2,1-4H3,(H,33,36)/b32-17- |
| InChIKey | MGHYUUQGKYERPA-KYHGBAKBSA-N |
| XLogP | 5.76 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.54 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|