C28H28ClN5O5S — CID 124531732
N-[(Z)-(3-chloro-5-methyl-1-phenylpyrazol-4-yl)methylideneamino]-2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 124531732) has the molecular formula C28H28ClN5O5S and a molecular weight of 582.08 g/mol. Its IUPAC name is N-[(Z)-(3-chloro-5-methyl-1-phenylpyrazol-4-yl)methylideneamino]-2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(Z)-(3-chloro-5-methyl-1-phenylpyrazol-4-yl)methylideneamino]-2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 124531732 |
| Molecular Formula | C28H28ClN5O5S |
| Molecular Weight | 582.08 g/mol |
| Exact Mass | 581.15 |
| IUPAC Name | N-[(Z)-(3-chloro-5-methyl-1-phenylpyrazol-4-yl)methylideneamino]-2-(2,5-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)N/N=C\c2c(Cl)nn(-c3ccccc3)c2C)S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C28H28ClN5O5S/c1-19-10-13-23(14-11-19)40(36,37)33(25-16-22(38-3)12-15-26(25)39-4)18-27(35)31-30-17-24-20(2)34(32-28(24)29)21-8-6-5-7-9-21/h5-17H,18H2,1-4H3,(H,31,35)/b30-17- |
| InChIKey | VVVQNPNAYTVDGG-LQNQUEJISA-N |
| XLogP | 4.51 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.08 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|