C32H33F3N4O5S — CID 126005766
2-[(3,4-dimethoxyphenyl)sulfonyl-(2-phenylethyl)amino]-N-[(E)-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]acetamide (PubChem CID 126005766) has the molecular formula C32H33F3N4O5S and a molecular weight of 642.70 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)sulfonyl-(2-phenylethyl)amino]-N-[(E)-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)sulfonyl-(2-phenylethyl)amino]-N-[(E)-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126005766 |
| Molecular Formula | C32H33F3N4O5S |
| Molecular Weight | 642.70 g/mol |
| Exact Mass | 642.21 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)sulfonyl-(2-phenylethyl)amino]-N-[(E)-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCc2ccccc2)CC(=O)N/N=C/c2cc(C)n(-c3ccccc3C(F)(F)F)c2C)cc1OC |
| InChI | InChI=1S/C32H33F3N4O5S/c1-22-18-25(23(2)39(22)28-13-9-8-12-27(28)32(33,34)35)20-36-37-31(40)21-38(17-16-24-10-6-5-7-11-24)45(41,42)26-14-15-29(43-3)30(19-26)44-4/h5-15,18-20H,16-17,21H2,1-4H3,(H,37,40)/b36-20+ |
| InChIKey | SSWTVNGJIVNEGL-ZSNJKBEMSA-N |
| XLogP | 5.51 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.70 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|