C31H33ClN4O5S — CID 98093782
N-[(E)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[(3,4-dimethoxyphenyl)sulfonyl-(2-phenylethyl)amino]acetamide (PubChem CID 98093782) has the molecular formula C31H33ClN4O5S and a molecular weight of 609.15 g/mol. Its IUPAC name is N-[(E)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[(3,4-dimethoxyphenyl)sulfonyl-(2-phenylethyl)amino]acetamide.
| Compound Name | N-[(E)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[(3,4-dimethoxyphenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
|---|---|
| PubChem CID | 98093782 |
| Molecular Formula | C31H33ClN4O5S |
| Molecular Weight | 609.15 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | N-[(E)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[(3,4-dimethoxyphenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCc2ccccc2)CC(=O)N/N=C/c2cc(C)n(-c3ccccc3Cl)c2C)cc1OC |
| InChI | InChI=1S/C31H33ClN4O5S/c1-22-18-25(23(2)36(22)28-13-9-8-12-27(28)32)20-33-34-31(37)21-35(17-16-24-10-6-5-7-11-24)42(38,39)26-14-15-29(40-3)30(19-26)41-4/h5-15,18-20H,16-17,21H2,1-4H3,(H,34,37)/b33-20+ |
| InChIKey | CWGNITFDWLGNQH-FMFFXOCNSA-N |
| XLogP | 5.15 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.15 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|