C29H27Cl3N4O3S — CID 6090447
2-[(4-chlorophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide (PubChem CID 6090447) has the molecular formula C29H27Cl3N4O3S and a molecular weight of 617.99 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6090447 |
| Molecular Formula | C29H27Cl3N4O3S |
| Molecular Weight | 617.99 g/mol |
| Exact Mass | 616.09 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-(2-phenylethyl)amino]-N-[(Z)-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
| SMILES | Cc1cc(/C=N\NC(=O)CN(CCc2ccccc2)S(=O)(=O)c2ccc(Cl)cc2)c(C)n1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C29H27Cl3N4O3S/c1-20-16-23(21(2)36(20)25-10-13-27(31)28(32)17-25)18-33-34-29(37)19-35(15-14-22-6-4-3-5-7-22)40(38,39)26-11-8-24(30)9-12-26/h3-13,16-18H,14-15,19H2,1-2H3,(H,34,37)/b33-18- |
| InChIKey | OISPPCWCVSKOSI-OHUYPAJKSA-N |
| XLogP | 6.44 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.99 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|