C24H20FN5O5S2 — CID 43910550
2-[N-(benzenesulfonyl)-2-fluoroanilino]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide (PubChem CID 43910550) has the molecular formula C24H20FN5O5S2 and a molecular weight of 541.59 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-fluoroanilino]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-fluoroanilino]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 43910550 |
| Molecular Formula | C24H20FN5O5S2 |
| Molecular Weight | 541.59 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-fluoroanilino]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(CN(c1ccccc1F)S(=O)(=O)c1ccccc1)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C24H20FN5O5S2/c25-21-9-4-5-10-22(21)30(37(34,35)20-7-2-1-3-8-20)17-23(31)28-18-11-13-19(14-12-18)36(32,33)29-24-26-15-6-16-27-24/h1-16H,17H2,(H,28,31)(H,26,27,29) |
| InChIKey | AUXTXJBYIUIXRR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |