C24H32N2O — CID 100711058
2,4,5-trimethyl-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]benzamide (PubChem CID 100711058) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is 2,4,5-trimethyl-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]benzamide.
| Compound Name | 2,4,5-trimethyl-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 100711058 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 2,4,5-trimethyl-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]benzamide |
| SMILES | Cc1cc(C)c(C(=O)N[C@H](C)c2ccc(N3CCC(C)CC3)cc2)cc1C |
| InChI | InChI=1S/C24H32N2O/c1-16-10-12-26(13-11-16)22-8-6-21(7-9-22)20(5)25-24(27)23-15-18(3)17(2)14-19(23)4/h6-9,14-16,20H,10-13H2,1-5H3,(H,25,27)/t20-/m1/s1 |
| InChIKey | KHRFIYNRTMHULO-HXUWFJFHSA-N |
| XLogP | 5.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|