C31H39N3O3S — CID 125048994
4-[(2,5-dimethyl-N-methylsulfonylanilino)methyl]-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]benzamide (PubChem CID 125048994) has the molecular formula C31H39N3O3S and a molecular weight of 533.74 g/mol. Its IUPAC name is 4-[(2,5-dimethyl-N-methylsulfonylanilino)methyl]-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]benzamide.
| Compound Name | 4-[(2,5-dimethyl-N-methylsulfonylanilino)methyl]-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 125048994 |
| Molecular Formula | C31H39N3O3S |
| Molecular Weight | 533.74 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | 4-[(2,5-dimethyl-N-methylsulfonylanilino)methyl]-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]benzamide |
| SMILES | Cc1ccc(C)c(N(Cc2ccc(C(=O)N[C@H](C)c3ccc(N4CCC(C)CC4)cc3)cc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C31H39N3O3S/c1-22-16-18-33(19-17-22)29-14-12-27(13-15-29)25(4)32-31(35)28-10-8-26(9-11-28)21-34(38(5,36)37)30-20-23(2)6-7-24(30)3/h6-15,20,22,25H,16-19,21H2,1-5H3,(H,32,35)/t25-/m1/s1 |
| InChIKey | GVLAKXYPZCHBCI-RUZDIDTESA-N |
| XLogP | 6.00 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.74 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|