C30H37N3O3S — CID 100589214
4-[(2,5-dimethyl-N-methylsulfonylanilino)methyl]-N-[(1S)-1-(4-piperidin-1-ylphenyl)ethyl]benzamide (PubChem CID 100589214) has the molecular formula C30H37N3O3S and a molecular weight of 519.71 g/mol. Its IUPAC name is 4-[(2,5-dimethyl-N-methylsulfonylanilino)methyl]-N-[(1S)-1-(4-piperidin-1-ylphenyl)ethyl]benzamide.
| Compound Name | 4-[(2,5-dimethyl-N-methylsulfonylanilino)methyl]-N-[(1S)-1-(4-piperidin-1-ylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 100589214 |
| Molecular Formula | C30H37N3O3S |
| Molecular Weight | 519.71 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 4-[(2,5-dimethyl-N-methylsulfonylanilino)methyl]-N-[(1S)-1-(4-piperidin-1-ylphenyl)ethyl]benzamide |
| SMILES | Cc1ccc(C)c(N(Cc2ccc(C(=O)N[C@@H](C)c3ccc(N4CCCCC4)cc3)cc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C30H37N3O3S/c1-22-8-9-23(2)29(20-22)33(37(4,35)36)21-25-10-12-27(13-11-25)30(34)31-24(3)26-14-16-28(17-15-26)32-18-6-5-7-19-32/h8-17,20,24H,5-7,18-19,21H2,1-4H3,(H,31,34)/t24-/m0/s1 |
| InChIKey | UGNNPCZEHNZZAX-DEOSSOPVSA-N |
| XLogP | 5.75 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.71 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|